C27H22N2O4 — CID 45054712
[1-[(E)-[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate (PubChem CID 45054712) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is [1-[(E)-[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate.
| Compound Name | [1-[(E)-[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate |
|---|---|
| PubChem CID | 45054712 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [1-[(E)-[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc3ccccc3c2/C=N/NC(=O)C(O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H22N2O4/c1-18-8-7-12-21(16-18)27(32)33-24-15-14-19-9-5-6-13-22(19)23(24)17-28-29-26(31)25(30)20-10-3-2-4-11-20/h2-17,25,30H,1H3,(H,29,31)/b28-17+ |
| InChIKey | BRZYAYGKRXNVAK-OGLMXYFKSA-N |
| XLogP | 4.55 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|