C27H19Cl2N3O4 — CID 6009518
[1-[(Z)-[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate (PubChem CID 6009518) has the molecular formula C27H19Cl2N3O4 and a molecular weight of 520.37 g/mol. Its IUPAC name is [1-[(Z)-[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate.
| Compound Name | [1-[(Z)-[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate |
|---|---|
| PubChem CID | 6009518 |
| Molecular Formula | C27H19Cl2N3O4 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | [1-[(Z)-[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc3ccccc3c2/C=N\NC(=O)C(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C27H19Cl2N3O4/c1-16-5-4-7-18(13-16)27(35)36-24-12-9-17-6-2-3-8-20(17)21(24)15-30-32-26(34)25(33)31-19-10-11-22(28)23(29)14-19/h2-15H,1H3,(H,31,33)(H,32,34)/b30-15- |
| InChIKey | IUSJKPSWXSORIQ-MNDYBZJGSA-N |
| XLogP | 5.76 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|