C33H24Cl2N2O4 — CID 51060167
[1-[(E)-[2-(4-phenylphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 51060167) has the molecular formula C33H24Cl2N2O4 and a molecular weight of 583.47 g/mol. Its IUPAC name is [1-[(E)-[2-(4-phenylphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[(E)-[2-(4-phenylphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 51060167 |
| Molecular Formula | C33H24Cl2N2O4 |
| Molecular Weight | 583.47 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | [1-[(E)-[2-(4-phenylphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | CC(Oc1ccc(-c2ccccc2)cc1)C(=O)N/N=C/c1c(OC(=O)c2ccc(Cl)cc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C33H24Cl2N2O4/c1-21(40-26-15-11-23(12-16-26)22-7-3-2-4-8-22)32(38)37-36-20-29-27-10-6-5-9-24(27)13-18-31(29)41-33(39)28-17-14-25(34)19-30(28)35/h2-21H,1H3,(H,37,38)/b36-20+ |
| InChIKey | KIQPFDOOLVKKSG-ZSNJKBEMSA-N |
| XLogP | 7.95 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.47 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|