C30H27ClN2O5 — CID 6164462
[1-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate (PubChem CID 6164462) has the molecular formula C30H27ClN2O5 and a molecular weight of 531.01 g/mol. Its IUPAC name is [1-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate.
| Compound Name | [1-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6164462 |
| Molecular Formula | C30H27ClN2O5 |
| Molecular Weight | 531.01 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | [1-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
| SMILES | CCCCOc1ccc(OCC(=O)N/N=C\c2c(OC(=O)c3ccccc3Cl)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C30H27ClN2O5/c1-2-3-18-36-22-13-15-23(16-14-22)37-20-29(34)33-32-19-26-24-9-5-4-8-21(24)12-17-28(26)38-30(35)25-10-6-7-11-27(25)31/h4-17,19H,2-3,18,20H2,1H3,(H,33,34)/b32-19- |
| InChIKey | PFZWBTRYGVVCCO-MZFJOGFUSA-N |
| XLogP | 6.42 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.01 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|