C25H18ClN3O3 — CID 136897219
2-[(4-chlorobenzoyl)amino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide (PubChem CID 136897219) has the molecular formula C25H18ClN3O3 and a molecular weight of 443.89 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)amino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide.
| Compound Name | 2-[(4-chlorobenzoyl)amino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 136897219 |
| Molecular Formula | C25H18ClN3O3 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-[(4-chlorobenzoyl)amino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)N/N=C\c1c(O)ccc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18ClN3O3/c26-18-12-9-17(10-13-18)24(31)28-22-8-4-3-7-20(22)25(32)29-27-15-21-19-6-2-1-5-16(19)11-14-23(21)30/h1-15,30H,(H,28,31)(H,29,32)/b27-15- |
| InChIKey | GUQWKKAYCQTWKE-DICXZTSXSA-N |
| XLogP | 5.22 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|