C29H20BrN3O2 — CID 126002059
N-[(Z)-anthracen-9-ylmethylideneamino]-2-[(4-bromobenzoyl)amino]benzamide (PubChem CID 126002059) has the molecular formula C29H20BrN3O2 and a molecular weight of 522.40 g/mol. Its IUPAC name is N-[(Z)-anthracen-9-ylmethylideneamino]-2-[(4-bromobenzoyl)amino]benzamide.
| Compound Name | N-[(Z)-anthracen-9-ylmethylideneamino]-2-[(4-bromobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 126002059 |
| Molecular Formula | C29H20BrN3O2 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | N-[(Z)-anthracen-9-ylmethylideneamino]-2-[(4-bromobenzoyl)amino]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)N/N=C\c1c2ccccc2cc2ccccc12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H20BrN3O2/c30-22-15-13-19(14-16-22)28(34)32-27-12-6-5-11-25(27)29(35)33-31-18-26-23-9-3-1-7-20(23)17-21-8-2-4-10-24(21)26/h1-18H,(H,32,34)(H,33,35)/b31-18- |
| InChIKey | CRSKJHHLPXWAAZ-MNBJERMJSA-N |
| XLogP | 6.77 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|