C18H14ClN3O4S2 — CID 2118005
N-[(5-chloro-2-hydroxyphenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 2118005) has the molecular formula C18H14ClN3O4S2 and a molecular weight of 435.91 g/mol. Its IUPAC name is N-[(5-chloro-2-hydroxyphenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(5-chloro-2-hydroxyphenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 2118005 |
| Molecular Formula | C18H14ClN3O4S2 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | N-[(5-chloro-2-hydroxyphenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NN=Cc1cc(Cl)ccc1O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H14ClN3O4S2/c19-13-7-8-16(23)12(10-13)11-20-21-18(24)14-4-1-2-5-15(14)22-28(25,26)17-6-3-9-27-17/h1-11,22-23H,(H,21,24) |
| InChIKey | POSYUJQFCWGVAJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|