C17H15N3O3S3 — CID 6305629
N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 6305629) has the molecular formula C17H15N3O3S3 and a molecular weight of 405.53 g/mol. Its IUPAC name is N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 6305629 |
| Molecular Formula | C17H15N3O3S3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | Cc1ccsc1/C=N\NC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H15N3O3S3/c1-12-8-10-24-15(12)11-18-19-17(21)13-5-2-3-6-14(13)20-26(22,23)16-7-4-9-25-16/h2-11,20H,1H3,(H,19,21)/b18-11- |
| InChIKey | KQVDEPXYKTZRFE-WQRHYEAKSA-N |
| XLogP | 3.68 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|