C24H23N5O3S2 — CID 6893110
N-[(E)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 6893110) has the molecular formula C24H23N5O3S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[(E)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(E)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 6893110 |
| Molecular Formula | C24H23N5O3S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-[(E)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1/C=N/NC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C24H23N5O3S2/c1-17-21(18(2)29(27-17)16-19-9-4-3-5-10-19)15-25-26-24(30)20-11-6-7-12-22(20)28-34(31,32)23-13-8-14-33-23/h3-15,28H,16H2,1-2H3,(H,26,30)/b25-15+ |
| InChIKey | CXRKSLINPBDIQP-MFKUBSTISA-N |
| XLogP | 4.17 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|