C18H18BrN5O — CID 8983018
N-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-4-bromo-1H-pyrrole-2-carboxamide (PubChem CID 8983018) has the molecular formula C18H18BrN5O and a molecular weight of 400.28 g/mol. Its IUPAC name is N-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-4-bromo-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-4-bromo-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8983018 |
| Molecular Formula | C18H18BrN5O |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-4-bromo-1H-pyrrole-2-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1/C=N\NC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C18H18BrN5O/c1-12-16(10-21-22-18(25)17-8-15(19)9-20-17)13(2)24(23-12)11-14-6-4-3-5-7-14/h3-10,20H,11H2,1-2H3,(H,22,25)/b21-10- |
| InChIKey | ISMAHUVSZMNLRW-FBHDLOMBSA-N |
| XLogP | 3.40 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|