C18H16BrN3O2 — CID 8983110
4-bromo-N-[(Z)-(2-ethoxynaphthalen-1-yl)methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 8983110) has the molecular formula C18H16BrN3O2 and a molecular weight of 386.25 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-(2-ethoxynaphthalen-1-yl)methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-(2-ethoxynaphthalen-1-yl)methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8983110 |
| Molecular Formula | C18H16BrN3O2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 4-bromo-N-[(Z)-(2-ethoxynaphthalen-1-yl)methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | CCOc1ccc2ccccc2c1/C=N\NC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C18H16BrN3O2/c1-2-24-17-8-7-12-5-3-4-6-14(12)15(17)11-21-22-18(23)16-9-13(19)10-20-16/h3-11,20H,2H2,1H3,(H,22,23)/b21-11- |
| InChIKey | OQRWBHGQOHHVKR-NHDPSOOVSA-N |
| XLogP | 4.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|