C14H12BrN3O4 — CID 8982713
2-[2-[(Z)-[(4-bromo-1H-pyrrole-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 8982713) has the molecular formula C14H12BrN3O4 and a molecular weight of 366.17 g/mol. Its IUPAC name is 2-[2-[(Z)-[(4-bromo-1H-pyrrole-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(Z)-[(4-bromo-1H-pyrrole-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 8982713 |
| Molecular Formula | C14H12BrN3O4 |
| Molecular Weight | 366.17 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 2-[2-[(Z)-[(4-bromo-1H-pyrrole-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1/C=N\NC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C14H12BrN3O4/c15-10-5-11(16-7-10)14(21)18-17-6-9-3-1-2-4-12(9)22-8-13(19)20/h1-7,16H,8H2,(H,18,21)(H,19,20)/b17-6- |
| InChIKey | JHLYEXNJESNZCW-FMQZQXMHSA-N |
| XLogP | 2.00 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|