C14H14BrN3O3 — CID 8982588
4-bromo-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 8982588) has the molecular formula C14H14BrN3O3 and a molecular weight of 352.19 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8982588 |
| Molecular Formula | C14H14BrN3O3 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 4-bromo-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | COc1cccc(/C=N\NC(=O)c2cc(Br)c[nH]2)c1OC |
| InChI | InChI=1S/C14H14BrN3O3/c1-20-12-5-3-4-9(13(12)21-2)7-17-18-14(19)11-6-10(15)8-16-11/h3-8,16H,1-2H3,(H,18,19)/b17-7- |
| InChIKey | DIXHTECZGBHJNP-IDUWFGFVSA-N |
| XLogP | 2.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|