C16H15BrN4O — CID 135846604
4-bromo-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 135846604) has the molecular formula C16H15BrN4O and a molecular weight of 359.23 g/mol. Its IUPAC name is 4-bromo-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 135846604 |
| Molecular Formula | C16H15BrN4O |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 4-bromo-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | CCc1cccc2c(/C=N/NC(=O)c3cc(Br)c[nH]3)c[nH]c12 |
| InChI | InChI=1S/C16H15BrN4O/c1-2-10-4-3-5-13-11(7-19-15(10)13)8-20-21-16(22)14-6-12(17)9-18-14/h3-9,18-19H,2H2,1H3,(H,21,22)/b20-8+ |
| InChIKey | JKXNBKMGJBDELQ-DNTJNYDQSA-N |
| XLogP | 3.58 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|