C17H14Cl3N5O — CID 4320116
4-amino-3,5,6-trichloro-N-[(7-ethyl-1H-indol-3-yl)methylideneamino]pyridine-2-carboxamide (PubChem CID 4320116) has the molecular formula C17H14Cl3N5O and a molecular weight of 410.69 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(7-ethyl-1H-indol-3-yl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(7-ethyl-1H-indol-3-yl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 4320116 |
| Molecular Formula | C17H14Cl3N5O |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(7-ethyl-1H-indol-3-yl)methylideneamino]pyridine-2-carboxamide |
| SMILES | CCc1cccc2c(C=NNC(=O)c3nc(Cl)c(Cl)c(N)c3Cl)c[nH]c12 |
| InChI | InChI=1S/C17H14Cl3N5O/c1-2-8-4-3-5-10-9(6-22-14(8)10)7-23-25-17(26)15-11(18)13(21)12(19)16(20)24-15/h3-7,22H,2H2,1H3,(H2,21,24)(H,25,26) |
| InChIKey | GCASQYHQKWNZJK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|