C13H9Cl3N4O2 — CID 135719888
4-amino-3,5,6-trichloro-N-[(E)-(4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide (PubChem CID 135719888) has the molecular formula C13H9Cl3N4O2 and a molecular weight of 359.60 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-(4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-(4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135719888 |
| Molecular Formula | C13H9Cl3N4O2 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-(4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)N/N=C/c2ccc(O)cc2)c1Cl |
| InChI | InChI=1S/C13H9Cl3N4O2/c14-8-10(17)9(15)12(16)19-11(8)13(22)20-18-5-6-1-3-7(21)4-2-6/h1-5,21H,(H2,17,19)(H,20,22)/b18-5+ |
| InChIKey | AUPKEQORZJKQKN-BLLMUTORSA-N |
| XLogP | 3.09 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|