C15H13Cl3N4O — CID 9214671
4-amino-3,5,6-trichloro-N-[(Z)-[(2R)-2-phenylpropylidene]amino]pyridine-2-carboxamide (PubChem CID 9214671) has the molecular formula C15H13Cl3N4O and a molecular weight of 371.66 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(Z)-[(2R)-2-phenylpropylidene]amino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(Z)-[(2R)-2-phenylpropylidene]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 9214671 |
| Molecular Formula | C15H13Cl3N4O |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(Z)-[(2R)-2-phenylpropylidene]amino]pyridine-2-carboxamide |
| SMILES | C[C@@H](/C=N\NC(=O)c1nc(Cl)c(Cl)c(N)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H13Cl3N4O/c1-8(9-5-3-2-4-6-9)7-20-22-15(23)13-10(16)12(19)11(17)14(18)21-13/h2-8H,1H3,(H2,19,21)(H,22,23)/b20-7-/t8-/m0/s1 |
| InChIKey | HBTNJEMJGITAOK-VCDONSGXSA-N |
| XLogP | 4.14 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|