C15H10BrCl3N4O — CID 42995579
4-amino-N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3,5,6-trichloropyridine-2-carboxamide (PubChem CID 42995579) has the molecular formula C15H10BrCl3N4O and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-amino-N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3,5,6-trichloropyridine-2-carboxamide.
| Compound Name | 4-amino-N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3,5,6-trichloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 42995579 |
| Molecular Formula | C15H10BrCl3N4O |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 445.91 |
| IUPAC Name | 4-amino-N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3,5,6-trichloropyridine-2-carboxamide |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)N/N=C/C(Br)=C/c2ccccc2)c1Cl |
| InChI | InChI=1S/C15H10BrCl3N4O/c16-9(6-8-4-2-1-3-5-8)7-21-23-15(24)13-10(17)12(20)11(18)14(19)22-13/h1-7H,(H2,20,22)(H,23,24)/b9-6-,21-7+ |
| InChIKey | JOZRDNIYURLUBI-OMVDTVFKSA-N |
| XLogP | 4.78 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|