C13H7Cl5N4O — CID 2487316
4-amino-3,5,6-trichloro-N-[(3,4-dichlorophenyl)methylideneamino]pyridine-2-carboxamide (PubChem CID 2487316) has the molecular formula C13H7Cl5N4O and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(3,4-dichlorophenyl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(3,4-dichlorophenyl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 2487316 |
| Molecular Formula | C13H7Cl5N4O |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(3,4-dichlorophenyl)methylideneamino]pyridine-2-carboxamide |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)NN=Cc2ccc(Cl)c(Cl)c2)c1Cl |
| InChI | InChI=1S/C13H7Cl5N4O/c14-6-2-1-5(3-7(6)15)4-20-22-13(23)11-8(16)10(19)9(17)12(18)21-11/h1-4H,(H2,19,21)(H,22,23) |
| InChIKey | IMZSDIFWVOYVLA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|