C14H11Cl3N4O3 — CID 5012984
4-amino-3,5,6-trichloro-N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]pyridine-2-carboxamide (PubChem CID 5012984) has the molecular formula C14H11Cl3N4O3 and a molecular weight of 389.63 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 5012984 |
| Molecular Formula | C14H11Cl3N4O3 |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]pyridine-2-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)cc1O |
| InChI | InChI=1S/C14H11Cl3N4O3/c1-24-8-3-2-6(4-7(8)22)5-19-21-14(23)12-9(15)11(18)10(16)13(17)20-12/h2-5,22H,1H3,(H2,18,20)(H,21,23) |
| InChIKey | DTRLXMGOIPEZTO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|