C22H18Cl3N5O5 — CID 1417305
4-amino-3,5,6-trichloro-N-[[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methylideneamino]pyridine-2-carboxamide (PubChem CID 1417305) has the molecular formula C22H18Cl3N5O5 and a molecular weight of 538.78 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 1417305 |
| Molecular Formula | C22H18Cl3N5O5 |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 537.04 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methylideneamino]pyridine-2-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)cc1COc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C22H18Cl3N5O5/c1-11-7-14(4-5-15(11)30(32)33)35-10-13-8-12(3-6-16(13)34-2)9-27-29-22(31)20-17(23)19(26)18(24)21(25)28-20/h3-9H,10H2,1-2H3,(H2,26,28)(H,29,31) |
| InChIKey | AIOXQNCDLVWSPW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|