C22H22ClIN4O3 — CID 98091571
N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 98091571) has the molecular formula C22H22ClIN4O3 and a molecular weight of 552.80 g/mol. Its IUPAC name is N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98091571 |
| Molecular Formula | C22H22ClIN4O3 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2nn(C)cc2I)cc1COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C22H22ClIN4O3/c1-13-7-17(8-14(2)20(13)23)31-12-16-9-15(5-6-19(16)30-4)10-25-26-22(29)21-18(24)11-28(3)27-21/h5-11H,12H2,1-4H3,(H,26,29)/b25-10- |
| InChIKey | VCEYBZJKIIASAL-MRUKODCESA-N |
| XLogP | 4.65 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|