C22H23ClN4O3S — CID 6272239
2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]acetamide (PubChem CID 6272239) has the molecular formula C22H23ClN4O3S and a molecular weight of 458.97 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6272239 |
| Molecular Formula | C22H23ClN4O3S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)Cc2csc(N)n2)cc1COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C22H23ClN4O3S/c1-13-6-18(7-14(2)21(13)23)30-11-16-8-15(4-5-19(16)29-3)10-25-27-20(28)9-17-12-31-22(24)26-17/h4-8,10,12H,9,11H2,1-3H3,(H2,24,26)(H,27,28)/b25-10- |
| InChIKey | HLSIAIINHNUUIC-MRUKODCESA-N |
| XLogP | 4.28 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|