C21H22ClN3O2S — CID 168617609
N-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168617609) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is N-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168617609 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(C=NNc2nc(C)cs2)cc1COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C21H22ClN3O2S/c1-13-7-18(8-14(2)20(13)22)27-11-17-9-16(5-6-19(17)26-4)10-23-25-21-24-15(3)12-28-21/h5-10,12H,11H2,1-4H3,(H,24,25) |
| InChIKey | NVSKIHFAPXFENO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|