C18H15Cl3N4O2S — CID 168626322
2-N-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626322) has the molecular formula C18H15Cl3N4O2S and a molecular weight of 457.77 g/mol. Its IUPAC name is 2-N-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626322 |
| Molecular Formula | C18H15Cl3N4O2S |
| Molecular Weight | 457.77 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 2-N-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | COc1ccc(C=NNc2nc(N)cs2)cc1COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl3N4O2S/c1-26-15-3-2-10(7-23-25-18-24-16(22)9-28-18)4-11(15)8-27-17-13(20)5-12(19)6-14(17)21/h2-7,9H,8,22H2,1H3,(H,24,25) |
| InChIKey | GBNQEOOCDALDAX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.77 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|