C19H18Cl2N4O2S — CID 168627506
2-N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627506) has the molecular formula C19H18Cl2N4O2S and a molecular weight of 437.35 g/mol. Its IUPAC name is 2-N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627506 |
| Molecular Formula | C19H18Cl2N4O2S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | CCOc1cc(C=NNc2nc(N)cs2)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C19H18Cl2N4O2S/c1-2-26-16-8-12(9-23-25-19-24-17(22)11-28-19)7-15(21)18(16)27-10-13-5-3-4-6-14(13)20/h3-9,11H,2,10,22H2,1H3,(H,24,25) |
| InChIKey | FJAYGPFUHKQHKR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|