C22H20Cl2N2O2 — CID 169383336
N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]aniline (PubChem CID 169383336) has the molecular formula C22H20Cl2N2O2 and a molecular weight of 415.32 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]aniline.
| Compound Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 169383336 |
| Molecular Formula | C22H20Cl2N2O2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]aniline |
| SMILES | CCOc1cc(C=NNc2ccccc2)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O2/c1-2-27-21-13-16(14-25-26-18-9-4-3-5-10-18)12-20(24)22(21)28-15-17-8-6-7-11-19(17)23/h3-14,26H,2,15H2,1H3 |
| InChIKey | VQMDLSHFDVJZRD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|