C24H23ClIN3O3 — CID 126390386
2-anilino-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]acetamide (PubChem CID 126390386) has the molecular formula C24H23ClIN3O3 and a molecular weight of 563.82 g/mol. Its IUPAC name is 2-anilino-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126390386 |
| Molecular Formula | C24H23ClIN3O3 |
| Molecular Weight | 563.82 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | 2-anilino-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CNc2ccccc2)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H23ClIN3O3/c1-2-31-22-13-17(14-28-29-23(30)15-27-19-9-4-3-5-10-19)12-21(26)24(22)32-16-18-8-6-7-11-20(18)25/h3-14,27H,2,15-16H2,1H3,(H,29,30)/b28-14- |
| InChIKey | JRKDWYHTRDYBGQ-MUXKCCDJSA-N |
| XLogP | 5.48 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|