C26H26ClIN2O4 — CID 133169492
N-[(E)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-4-propoxybenzamide (PubChem CID 133169492) has the molecular formula C26H26ClIN2O4 and a molecular weight of 592.86 g/mol. Its IUPAC name is N-[(E)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-4-propoxybenzamide.
| Compound Name | N-[(E)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-4-propoxybenzamide |
|---|---|
| PubChem CID | 133169492 |
| Molecular Formula | C26H26ClIN2O4 |
| Molecular Weight | 592.86 g/mol |
| Exact Mass | 592.06 |
| IUPAC Name | N-[(E)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(I)c(OCc3ccccc3Cl)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H26ClIN2O4/c1-3-13-33-21-11-9-19(10-12-21)26(31)30-29-16-18-14-23(28)25(24(15-18)32-4-2)34-17-20-7-5-6-8-22(20)27/h5-12,14-16H,3-4,13,17H2,1-2H3,(H,30,31)/b29-16+ |
| InChIKey | NZOQUYCRTKEXMT-MUFRIFMGSA-N |
| XLogP | 6.47 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.86 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|