C28H25FIN3O3 — CID 126363332
N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-fluoroanilino)acetamide (PubChem CID 126363332) has the molecular formula C28H25FIN3O3 and a molecular weight of 597.43 g/mol. Its IUPAC name is N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-fluoroanilino)acetamide.
| Compound Name | N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 126363332 |
| Molecular Formula | C28H25FIN3O3 |
| Molecular Weight | 597.43 g/mol |
| Exact Mass | 597.09 |
| IUPAC Name | N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-fluoroanilino)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CNc2ccc(F)cc2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H25FIN3O3/c1-2-35-26-15-19(16-32-33-27(34)17-31-23-12-10-22(29)11-13-23)14-25(30)28(26)36-18-21-8-5-7-20-6-3-4-9-24(20)21/h3-16,31H,2,17-18H2,1H3,(H,33,34)/b32-16- |
| InChIKey | KLCWCWZPZPSFNA-ZMGVVAQMSA-N |
| XLogP | 6.12 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.43 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|