C26H22FN3O2 — CID 126357905
2-(4-fluoroanilino)-N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide (PubChem CID 126357905) has the molecular formula C26H22FN3O2 and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-fluoroanilino)-N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126357905 |
| Molecular Formula | C26H22FN3O2 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-(4-fluoroanilino)-N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccc(F)cc1)N/N=C\c1cccc(OCc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C26H22FN3O2/c27-22-11-13-23(14-12-22)28-17-26(31)30-29-16-19-5-3-9-24(15-19)32-18-21-8-4-7-20-6-1-2-10-25(20)21/h1-16,28H,17-18H2,(H,30,31)/b29-16- |
| InChIKey | ZMOUTXWEPNECAV-MWLSYYOVSA-N |
| XLogP | 5.12 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|