C28H24N2O4 — CID 126367131
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(E)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide (PubChem CID 126367131) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(E)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(E)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126367131 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(E)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)N/N=C/c1cccc(OCc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C28H24N2O4/c31-28(17-20-11-12-26-27(16-20)33-14-13-32-26)30-29-18-21-5-3-9-24(15-21)34-19-23-8-4-7-22-6-1-2-10-25(22)23/h1-12,15-16,18H,13-14,17,19H2,(H,30,31)/b29-18+ |
| InChIKey | IPKISHGWOIWEMT-RDRPBHBLSA-N |
| XLogP | 4.88 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|