C24H21ClN2O4 — CID 126371202
N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide (PubChem CID 126371202) has the molecular formula C24H21ClN2O4 and a molecular weight of 436.90 g/mol. Its IUPAC name is N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
| Compound Name | N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
|---|---|
| PubChem CID | 126371202 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)N/N=C\c1cccc(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C24H21ClN2O4/c25-21-7-2-1-5-19(21)16-31-20-6-3-4-18(12-20)15-26-27-24(28)14-17-8-9-22-23(13-17)30-11-10-29-22/h1-9,12-13,15H,10-11,14,16H2,(H,27,28)/b26-15- |
| InChIKey | VNHITZAPWQLQGO-YSMPRRRNSA-N |
| XLogP | 4.38 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|