C23H19ClN2O4 — CID 126273733
2-(1,3-benzodioxol-5-yl)-N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 126273733) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126273733 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N/N=C\c1cccc(OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H19ClN2O4/c24-19-7-4-16(5-8-19)14-28-20-3-1-2-18(10-20)13-25-26-23(27)12-17-6-9-21-22(11-17)30-15-29-21/h1-11,13H,12,14-15H2,(H,26,27)/b25-13- |
| InChIKey | NXPRJKYWRXOWEW-MXAYSNPKSA-N |
| XLogP | 4.34 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|