C23H17ClN2O6 — CID 4043604
[3-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 4043604) has the molecular formula C23H17ClN2O6 and a molecular weight of 452.85 g/mol. Its IUPAC name is [3-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [3-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 4043604 |
| Molecular Formula | C23H17ClN2O6 |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | [3-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(COc1cccc(Cl)c1)NN=Cc1cccc(OC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C23H17ClN2O6/c24-17-4-2-5-18(11-17)29-13-22(27)26-25-12-15-3-1-6-19(9-15)32-23(28)16-7-8-20-21(10-16)31-14-30-20/h1-12H,13-14H2,(H,26,27) |
| InChIKey | AQSLXPJKAFICOM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|