C23H19N3O7 — CID 144523426
[2-[2-[(2E)-2-[[3-(1,3-benzodioxole-5-carbonyloxy)phenyl]methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-oxidoazanium (PubChem CID 144523426) has the molecular formula C23H19N3O7 and a molecular weight of 449.42 g/mol. Its IUPAC name is [2-[2-[(2E)-2-[[3-(1,3-benzodioxole-5-carbonyloxy)phenyl]methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-oxidoazanium.
| Compound Name | [2-[2-[(2E)-2-[[3-(1,3-benzodioxole-5-carbonyloxy)phenyl]methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-oxidoazanium |
|---|---|
| PubChem CID | 144523426 |
| Molecular Formula | C23H19N3O7 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [2-[2-[(2E)-2-[[3-(1,3-benzodioxole-5-carbonyloxy)phenyl]methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-oxidoazanium |
| SMILES | O=C(COc1ccccc1[NH2+][O-])N/N=C/c1cccc(OC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C23H19N3O7/c27-22(13-30-19-7-2-1-6-18(19)26-29)25-24-12-15-4-3-5-17(10-15)33-23(28)16-8-9-20-21(11-16)32-14-31-20/h1-12H,13-14,26H2,(H,25,27)/b24-12+ |
| InChIKey | XDEVXZFRFLEVGC-WYMPLXKRSA-N |
| XLogP | 1.86 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|