C24H15ClN2O5S — CID 4221903
[3-[[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 4221903) has the molecular formula C24H15ClN2O5S and a molecular weight of 478.91 g/mol. Its IUPAC name is [3-[[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [3-[[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 4221903 |
| Molecular Formula | C24H15ClN2O5S |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | [3-[[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(Oc1cccc(C=NNC(=O)c2sc3ccccc3c2Cl)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H15ClN2O5S/c25-21-17-6-1-2-7-20(17)33-22(21)23(28)27-26-12-14-4-3-5-16(10-14)32-24(29)15-8-9-18-19(11-15)31-13-30-18/h1-12H,13H2,(H,27,28) |
| InChIKey | RRCLYICMVKKMSV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|