C23H14Cl2N2O3S — CID 6076614
[4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 6076614) has the molecular formula C23H14Cl2N2O3S and a molecular weight of 469.35 g/mol. Its IUPAC name is [4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6076614 |
| Molecular Formula | C23H14Cl2N2O3S |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | [4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N\NC(=O)c2sc3ccccc3c2Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H14Cl2N2O3S/c24-16-9-7-15(8-10-16)23(29)30-17-11-5-14(6-12-17)13-26-27-22(28)21-20(25)18-3-1-2-4-19(18)31-21/h1-13H,(H,27,28)/b26-13- |
| InChIKey | DUGZTONNVCUEJY-ZMFRSBBQSA-N |
| XLogP | 6.19 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|