C21H12BrClN2O4S — CID 4670241
[4-[[(5-bromofuran-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 4670241) has the molecular formula C21H12BrClN2O4S and a molecular weight of 503.76 g/mol. Its IUPAC name is [4-[[(5-bromofuran-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[[(5-bromofuran-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4670241 |
| Molecular Formula | C21H12BrClN2O4S |
| Molecular Weight | 503.76 g/mol |
| Exact Mass | 501.94 |
| IUPAC Name | [4-[[(5-bromofuran-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2sc3ccccc3c2Cl)cc1)c1ccc(Br)o1 |
| InChI | InChI=1S/C21H12BrClN2O4S/c22-17-10-9-15(29-17)20(26)25-24-11-12-5-7-13(8-6-12)28-21(27)19-18(23)14-3-1-2-4-16(14)30-19/h1-11H,(H,25,26) |
| InChIKey | MFTQKCZLMRHCOS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.76 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|