C23H14BrClN2O3S — CID 6187059
[3-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6187059) has the molecular formula C23H14BrClN2O3S and a molecular weight of 513.80 g/mol. Its IUPAC name is [3-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [3-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6187059 |
| Molecular Formula | C23H14BrClN2O3S |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | [3-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(N/N=C\c1cccc(OC(=O)c2sc3ccccc3c2Cl)c1)c1ccccc1Br |
| InChI | InChI=1S/C23H14BrClN2O3S/c24-18-10-3-1-8-16(18)22(28)27-26-13-14-6-5-7-15(12-14)30-23(29)21-20(25)17-9-2-4-11-19(17)31-21/h1-13H,(H,27,28)/b26-13- |
| InChIKey | PEIAGZVWUGWKJG-ZMFRSBBQSA-N |
| XLogP | 6.30 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|