C25H17Cl2N3O4S — CID 4559492
[3-[[[2-[(2-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 4559492) has the molecular formula C25H17Cl2N3O4S and a molecular weight of 526.40 g/mol. Its IUPAC name is [3-[[[2-[(2-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [3-[[[2-[(2-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4559492 |
| Molecular Formula | C25H17Cl2N3O4S |
| Molecular Weight | 526.40 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | [3-[[[2-[(2-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(CNC(=O)c1ccccc1Cl)NN=Cc1cccc(OC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C25H17Cl2N3O4S/c26-19-10-3-1-8-17(19)24(32)28-14-21(31)30-29-13-15-6-5-7-16(12-15)34-25(33)23-22(27)18-9-2-4-11-20(18)35-23/h1-13H,14H2,(H,28,32)(H,30,31) |
| InChIKey | VNPQOHANRLEGAO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|