C29H20ClN3O4S — CID 6296924
[4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6296924) has the molecular formula C29H20ClN3O4S and a molecular weight of 542.02 g/mol. Its IUPAC name is [4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6296924 |
| Molecular Formula | C29H20ClN3O4S |
| Molecular Weight | 542.02 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | [4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(CNC(=O)c1cccc2ccccc12)N/N=C\c1ccc(OC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C29H20ClN3O4S/c30-26-23-9-3-4-11-24(23)38-27(26)29(36)37-20-14-12-18(13-15-20)16-32-33-25(34)17-31-28(35)22-10-5-7-19-6-1-2-8-21(19)22/h1-16H,17H2,(H,31,35)(H,33,34)/b32-16- |
| InChIKey | VMAYFWWBUZHILM-ZMGVVAQMSA-N |
| XLogP | 5.81 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.02 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|