C25H20ClN3O5S2 — CID 4187386
[4-[[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 4187386) has the molecular formula C25H20ClN3O5S2 and a molecular weight of 542.04 g/mol. Its IUPAC name is [4-[[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4187386 |
| Molecular Formula | C25H20ClN3O5S2 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | [4-[[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)NN=Cc2ccc(OC(=O)c3sc4ccccc4c3Cl)cc2)cc1 |
| InChI | InChI=1S/C25H20ClN3O5S2/c1-16-6-12-19(13-7-16)36(32,33)28-15-22(30)29-27-14-17-8-10-18(11-9-17)34-25(31)24-23(26)20-4-2-3-5-21(20)35-24/h2-14,28H,15H2,1H3,(H,29,30) |
| InChIKey | LNIIKXULJZLJQH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|