C32H23ClN4O5S — CID 4156444
[4-[[[2-[2-[(4-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 4156444) has the molecular formula C32H23ClN4O5S and a molecular weight of 611.08 g/mol. Its IUPAC name is [4-[[[2-[2-[(4-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[[[2-[2-[(4-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4156444 |
| Molecular Formula | C32H23ClN4O5S |
| Molecular Weight | 611.08 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | [4-[[[2-[2-[(4-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)C(=O)NN=Cc2ccc(OC(=O)c3sc4ccccc4c3Cl)cc2)cc1 |
| InChI | InChI=1S/C32H23ClN4O5S/c1-19-10-14-21(15-11-19)35-29(38)23-6-2-4-8-25(23)36-30(39)31(40)37-34-18-20-12-16-22(17-13-20)42-32(41)28-27(33)24-7-3-5-9-26(24)43-28/h2-18H,1H3,(H,35,38)(H,36,39)(H,37,40) |
| InChIKey | TWMHEXKDSFJIAL-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.08 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|