C29H20BrClN4O5 — CID 6117413
[4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 6117413) has the molecular formula C29H20BrClN4O5 and a molecular weight of 619.86 g/mol. Its IUPAC name is [4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 6117413 |
| Molecular Formula | C29H20BrClN4O5 |
| Molecular Weight | 619.86 g/mol |
| Exact Mass | 618.03 |
| IUPAC Name | [4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | O=C(N/N=C\c1ccc(OC(=O)c2ccc(Br)cc2)cc1)C(=O)Nc1ccccc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H20BrClN4O5/c30-20-9-7-19(8-10-20)29(39)40-23-15-5-18(6-16-23)17-32-35-28(38)27(37)34-25-4-2-1-3-24(25)26(36)33-22-13-11-21(31)12-14-22/h1-17H,(H,33,36)(H,34,37)(H,35,38)/b32-17- |
| InChIKey | TXIXJFJGOLFMAF-KYHGBAKBSA-N |
| XLogP | 5.66 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.86 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|