C24H19ClN4O6 — CID 6024920
2-[4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 6024920) has the molecular formula C24H19ClN4O6 and a molecular weight of 494.89 g/mol. Its IUPAC name is 2-[4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6024920 |
| Molecular Formula | C24H19ClN4O6 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 2-[4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=N\NC(=O)C(=O)Nc2ccccc2C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H19ClN4O6/c25-16-7-9-17(10-8-16)27-22(32)19-3-1-2-4-20(19)28-23(33)24(34)29-26-13-15-5-11-18(12-6-15)35-14-21(30)31/h1-13H,14H2,(H,27,32)(H,28,33)(H,29,34)(H,30,31)/b26-13- |
| InChIKey | HYHLZOOGPWVXEC-ZMFRSBBQSA-N |
| XLogP | 3.14 |
| TPSA | 146.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|