C22H16ClN5O5 — CID 4091193
N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(4-nitrophenyl)methylideneamino]oxamide (PubChem CID 4091193) has the molecular formula C22H16ClN5O5 and a molecular weight of 465.85 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(4-nitrophenyl)methylideneamino]oxamide.
| Compound Name | N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(4-nitrophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4091193 |
| Molecular Formula | C22H16ClN5O5 |
| Molecular Weight | 465.85 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(4-nitrophenyl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccccc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClN5O5/c23-15-7-9-16(10-8-15)25-20(29)18-3-1-2-4-19(18)26-21(30)22(31)27-24-13-14-5-11-17(12-6-14)28(32)33/h1-13H,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | QMURDTQODVQTAU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 142.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|