C23H19N5O6 — CID 4148017
N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-[2-[(4-methylphenyl)carbamoyl]phenyl]oxamide (PubChem CID 4148017) has the molecular formula C23H19N5O6 and a molecular weight of 461.43 g/mol. Its IUPAC name is N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-[2-[(4-methylphenyl)carbamoyl]phenyl]oxamide.
| Compound Name | N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-[2-[(4-methylphenyl)carbamoyl]phenyl]oxamide |
|---|---|
| PubChem CID | 4148017 |
| Molecular Formula | C23H19N5O6 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-[2-[(4-methylphenyl)carbamoyl]phenyl]oxamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)C(=O)NN=Cc2cc([N+](=O)[O-])ccc2O)cc1 |
| InChI | InChI=1S/C23H19N5O6/c1-14-6-8-16(9-7-14)25-21(30)18-4-2-3-5-19(18)26-22(31)23(32)27-24-13-15-12-17(28(33)34)10-11-20(15)29/h2-13,29H,1H3,(H,25,30)(H,26,31)(H,27,32) |
| InChIKey | YRWGDIURFLCWTJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 163.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|