C15H12N4O5 — CID 3817140
N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-phenyloxamide (PubChem CID 3817140) has the molecular formula C15H12N4O5 and a molecular weight of 328.28 g/mol. Its IUPAC name is N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-phenyloxamide.
| Compound Name | N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-phenyloxamide |
|---|---|
| PubChem CID | 3817140 |
| Molecular Formula | C15H12N4O5 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-phenyloxamide |
| SMILES | O=C(NN=Cc1cc([N+](=O)[O-])ccc1O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H12N4O5/c20-13-7-6-12(19(23)24)8-10(13)9-16-18-15(22)14(21)17-11-4-2-1-3-5-11/h1-9,20H,(H,17,21)(H,18,22) |
| InChIKey | LNPAMUVLILUMQK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|