C9H9N3O5 — CID 3681346
methyl N-[(2-hydroxy-5-nitrophenyl)methylideneamino]carbamate (PubChem CID 3681346) has the molecular formula C9H9N3O5 and a molecular weight of 239.19 g/mol. Its IUPAC name is methyl N-[(2-hydroxy-5-nitrophenyl)methylideneamino]carbamate.
| Compound Name | methyl N-[(2-hydroxy-5-nitrophenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 3681346 |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | methyl N-[(2-hydroxy-5-nitrophenyl)methylideneamino]carbamate |
| SMILES | COC(=O)NN=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C9H9N3O5/c1-17-9(14)11-10-5-6-4-7(12(15)16)2-3-8(6)13/h2-5,13H,1H3,(H,11,14) |
| InChIKey | AYTAMGBUAXHVMF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|